
CAS 123863-99-0: 9,9-Dioctyl-9H-fluorene
Formula:C29H42
InChI:InChI=1S/C29H42/c1-3-5-7-9-11-17-23-29(24-18-12-10-8-6-4-2)27-21-15-13-19-25(27)26-20-14-16-22-28(26)29/h13-16,19-22H,3-12,17-18,23-24H2,1-2H3
InChI key:InChIKey=RXACYPFGPNTUNV-UHFFFAOYSA-N
SMILES:C(CCCCCCC)C1(CCCCCCCC)C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- 9,9-Dioctyl-9H-fluorene
- 9,9-Dioctylfluorene
- 9H-fluorene, 9,9-dioctyl-
- 9H-fluorene, 9,9-dioctyl-, homopolymer
- poly(9,9-dioctyl-9H-fluorene)
- 9,9-Di-n-octylfluorene
Sort by
Found 4 products.
9H-Fluorene, 9,9-dioctyl-
CAS:Formula:C29H42Purity:97%Color and Shape:LiquidMolecular weight:390.64389,9-Di-n-octylfluorene
CAS:9,9-Di-n-octylfluorene is a research chemical that has various applications in the field of chemistry and material science. It is a fluorine-containing compound that can be used as a building block for the synthesis of other organic compounds. 9,9-Di-n-octylfluorene has been found to have solubilizing properties, making it useful for dissolving certain substances such as fatty acids, antibodies, and oligosaccharides. Additionally, it has been shown to interact with neurotransmitters like acetylcholine and glutamate, as well as ion channels like chloride, potassium, and glycine receptors. This compound may also exhibit metabolic interactions with enzymes such as CYP2A6. Overall, 9,9-Di-n-octylfluorene is a versatile research chemical with diverse potential applications in various scientific fields.Formula:C29H42Purity:Min. 95%Molecular weight:390.66 g/mol9,9-Di-n-octylfluorene
CAS:Formula:C29H42Purity:>97.0%(HPLC)Color and Shape:White or Colorless to Yellow to Orange powder to lump to clear liquidMolecular weight:390.66