
CAS 124782-95-2: 6-BROMO-2-PIPERAZIN-1-YL-QUINOLINE
Formula:C13H14BrN3
InChI:InChI=1/C13H14BrN3/c14-11-2-3-12-10(9-11)1-4-13(16-12)17-7-5-15-6-8-17/h1-4,9,15H,5-8H2
SMILES:c1cc(nc2ccc(cc12)Br)N1CCNCC1
Synonyms:- 6-Bromoquipazine
Sort by
Found 3 products.
6-Bromo-2-Piperazin-1-yl-Quinoline
CAS:6-Bromo-2-Piperazin-1-yl-Quinoline is a versatile compound that has various applications in different industries. It can be used as an intermediate in the synthesis of butanol and polymers, due to its ability to react with hydroxyl groups. Additionally, it can react with sodium metal to form sodium silicide, which is used in the production of electrode materials. This compound is also utilized in the pharmaceutical industry for its brominated properties. It can be incorporated into copolymers or bioavailability enhancers to improve drug delivery systems. Furthermore, it has been studied for its potential antimicrobial properties against bacteria and fungi. In the field of research, 6-Bromo-2-Piperazin-1-yl-Quinoline is often used as a reagent or building block for synthesizing new compounds. Its unique structure allows for diverse modifications and functionalizations, making it a valuable tool for chemists exploring new chemical entities. Please noteFormula:C13H14N3BrPurity:Min. 95%Molecular weight:292.17 g/mol