
CAS 124845-04-1: 5-Cyclopropyl-4-isoxazolecarboxylic acid
Formula:C7H7NO3
InChI:InChI=1S/C7H7NO3/c9-7(10)5-3-8-11-6(5)4-1-2-4/h3-4H,1-2H2,(H,9,10)
InChI key:InChIKey=KIJMAOMSRMPYIY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(ON=C1)C2CC2
Synonyms:- 4-Isoxazolecarboxylic acid, 5-cyclopropyl-
- 4-Isoxazolecarboxylicacid,5-cyclopropyl-(9CI)
- 5-Cyclopropyl-4-isoxazolecarboxylic acid
- 5-Cyclopropylisoxazole-4-Carboxylic Acid
Sort by
Found 4 products.
5-Cyclopropylisoxazole-4-carboxylic acid
CAS:5-Cyclopropylisoxazole-4-carboxylic acidPurity:97%Molecular weight:153.14g/mol4-Isoxazolecarboxylic acid, 5-cyclopropyl-
CAS:Formula:C7H7NO3Purity:98%Color and Shape:SolidMolecular weight:153.13545-Cyclopropylisoxazole-4-carboxylic acid
CAS:5-Cyclopropylisoxazole-4-carboxylic acid is a versatile compound that has various applications in different fields. It can be used as a photocatalytic agent, particularly in the production of copolymers and polymers. Additionally, it is commonly utilized in research laboratories as a potassium source for experiments. This compound also exhibits inhibitory properties, making it useful as an inhibitor in various processes. Furthermore, 5-Cyclopropylisoxazole-4-carboxylic acid has been studied for its potential use as an anesthetic and has shown promising results. Its unique characteristics make it a valuable component in the development of new materials and chemical compounds.Formula:C7H7NO3Purity:Min. 95%Molecular weight:153.14 g/mol