CAS 1260-04-4: (2beta,3beta,4alpha)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
Formula:C29H44O6
InChI:InChI=1S/C29H44O6/c1-25(2)12-13-29(24(34)35)11-8-17-16(18(29)14-25)6-7-20-26(17,3)10-9-21-27(20,4)15-19(30)22(31)28(21,5)23(32)33/h18-22,30-31H,6-15H2,1-5H3,(H,32,33)(H,34,35)/t18-,19-,20-,21+,22-,26-,27+,28-,29+/m0/s1
InChI key:InChIKey=VZRKWGPIZJDNHC-LUNVCWBOSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@@](C(O)=O)(C)[C@@H](O)[C@@H](O)C3)[H])(CCC4=C2CC[C@]5(C(O)=O)[C@]4(CC(C)(C)CC5)[H])[H]
Synonyms:- 27-Norolean-13-ene-23,28-dioic acid, 2β,3β-dihydroxy-
- Senegenic acid
- Polygalic acid
- 27-Norolean-13-ene-23,28-dioic acid, 2,3-dihydroxy-, (2β,3β,4α)-
- (2β,3β,4α)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
Sort by
Found 7 products.
Polygalic acid
CAS:Carboxylic acid with alcohol functionFormula:C29H44O6Purity:≥ 95.0 % (HPLC)Molecular weight:488.66Polygalic acid
CAS:Polygalic acid (Senegenic acid), a triterpenoid saponin, is a major active ingredient in Polygala tenuifolia, shows expectorant, emetic and stimulant effects.Formula:C29H44O6Purity:99.24% - 99.52%Color and Shape:SolidMolecular weight:488.66Polygalic Acid
CAS:Polygalic acid, a triterpenoid saponin, shows expectorant, emetic and stimulant effects.Formula:C29H44O6Purity:95%~99%Color and Shape:PowderMolecular weight:488.665Polygalic acid
CAS:Polygalic acid is a saponin compound, which is derived from certain plant species, notably from the roots of Polygala. It is a naturally occurring surfactant, known for its ability to interact with cell membranes due to its amphiphilic nature. The mode of action of polygalic acid involves its integration into lipid bilayers, leading to increased membrane permeability. This characteristic impacts the movement of ions and molecules across cellular membranes, facilitating various biochemical processes. In scientific research, polygalic acid is utilized for its ability to modulate biological membranes, making it a valuable tool in the study of cellular functions and drug delivery systems. Its applications extend to pharmacological research, where it aids in the examination of drug interactions and membrane receptor studies. Additionally, the compound’s natural origin and bioactivity offer insights into its potential roles in therapeutic developments, particularly in enhancing the efficacy and bioavailability of pharmacological agents. The multifaceted applications of polygalic acid continue to be explored across various fields, including biochemistry, pharmacology, and drug development.Formula:C29H44O6Purity:Min. 95%Color and Shape:PowderMolecular weight:488.66 g/mol
