
CAS 129042-57-5: DL-3-Amino-3-(2-naphthyl)propionic acid
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c14-12(8-13(15)16)11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12H,8,14H2,(H,15,16)
SMILES:c1ccc2cc(ccc2c1)C(CC(=O)O)N
Synonyms:- 3-Amino-3-(Naphthalen-2-Yl)Propanoic Acid
- DL-3-Amino-3-(2-naphthyl)-propionic acid
Sort by
Found 4 products.
3-Amino-3-(2-naphthyl)propionic acid
CAS:3-Amino-3-(2-naphthyl)propionic acidPurity:98%Molecular weight:215.25g/mol2-Naphthalenepropanoic acid, β-amino-
CAS:Formula:C13H13NO2Purity:97%Color and Shape:SolidMolecular weight:215.2478DL-3-Amino-3-(2-naphthyl)propionic acid
CAS:DL-3-Amino-3-(2-naphthyl)propionic acid is an amino acid sequence that has been shown to have anticancer activity. The drug consists of a cyclic peptide that mimics the amino acid sequence of sarcosine, an intermediate in the production of proline. DL-3-Amino-3-(2-naphthyl)propionic acid is a prodrug that undergoes hydrolysis by esterases to release its active form, 3-(2-naphthyl)propionic acid. This active form binds to arginine residues in proteins and inhibits protein synthesis. DL-3-Amino-3-(2-naphthyl)propionic acid also has shown antiinflammatory effects and can be used as a medicine for various disorders such as cancer and cardiovascular diseases.Purity:Min. 95%DL-3-Amino-3-(2-naphthyl)propionic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:215.2519989013672