
CAS 129212-92-6: taxifolin-3-glucopyranoside
Formula:C21H22O12
InChI:InChI=1/C21H22O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-27,29-30H,6H2/t13-,15-,17+,18-,19+,20-,21+/m1/s1
Synonyms:- (2S-trans)-2-(3,4-Dihydroxyphenyl)-3-(beta-D-glucopyranosyloxy)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
- Taxifolin-3-O-beta-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3-(beta-D-glucopyranosyloxy)-2,3-dihydro-5,7-dihydroxy-, (2S-trans)-
- (2S,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-3-yl beta-D-glucopyranoside
- (2S,3S)-(-)-Glucodistylin
Sort by
Found 3 products.
(2S,3S)-(-)-Glucodistylin
CAS:(2S,3S)-(-)-Glucodistylin is a naturally occurring stilbene glycoside, classified as a phytochemical. It is sourced specifically from various plant species known for their rich secondary metabolite profiles. The compound is revered for its intricate stereochemistry and biological potential. The mode of action for (2S,3S)-(-)-Glucodistylin involves its interaction with biochemical pathways related to its antioxidant and anti-inflammatory properties. As a stilbene, it can modulate cell signaling processes and interact with various molecular targets, offering potential therapeutic applications. This compound is primarily utilized in research settings, focusing on its biological and pharmacological activities. Studies investigate its potential in combating oxidative stress and related ailments. Additionally, its efficacy in disease models provides insights into drug discovery and fundamental biological processes. Due to its complex structure, (2S,3S)-(-)-Glucodistylin is often examined in stereospecific biochemical research to unravel the nuances of its interaction with other biomolecules.Formula:C21H22O12Purity:Min. 95%Color and Shape:PowderMolecular weight:466.4 g/mol(2S,3S)-(-)-Glucodistylin
CAS:European beeches with beech scale have high levels of (2R,3R)-(+)-glucodistylin, (2S,3S)-(-)-glucodistylin, and 3-O-(β-D-xylopyranosyl)taxifolin.Formula:C21H22O12Purity:98%Color and Shape:SolidMolecular weight:466.39(2S,3S)-(-)-Glucodistylin
CAS:Formula:C21H22O12Purity:95%~99%Color and Shape:PowderMolecular weight:466.395