
CAS 13018-10-5: Torilin
Formula:C22H32O5
InChI:InChI=1S/C22H32O5/c1-8-12(2)21(25)26-20-9-13(3)16-11-19(24)14(4)17(16)10-18(20)22(6,7)27-15(5)23/h8,13,16,18,20H,9-11H2,1-7H3/b12-8-/t13-,16+,18-,20+/m0/s1
InChI key:InChIKey=IQWVFAXBJQKUDH-TXCQZRSTSA-N
SMILES:[C@@](OC(C)=O)(C)(C)[C@@H]1[C@H](OC(/C(=C\C)/C)=O)C[C@H](C)[C@@]2(C(C1)=C(C)C(=O)C2)[H]
Synonyms:- 1β-Guai-4-en-3-one, 8β,11-dihydroxy-, 11-acetate 2-methylcrotonate, (Z)-
- 2-Butenoic acid, 2-methyl-, (5S,6R,8S,8aR)-5-[1-(acetyloxy)-1-methylethyl]-1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-2-oxo-6-azulenyl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 5-[1-(acetyloxy)-1-methylethyl]-1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-2-oxo-6-azulenyl ester, [5S-[5α,6α(Z),8α,8aα]]-
- Torilin
Sort by
Found 4 products.
[(5S,8S,8aR)-5-(2-Acetyloxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] (Z)-2-methylbut-2-enoate
CAS:[(5S,8S,8aR)-5-(2-Acetyloxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] (Z)-2-methylbut-2-enoate is a bioactive compound that serves as a semi-synthetic derivative of a naturally occurring substance found predominantly in certain species of the Artemisia plant. Known for their diverse range of secondary metabolites, Artemisia species have been extensively studied for their various therapeutic properties. The compound operates by interfering with vital biochemical pathways in microbial cells, leading to disruptions in cell wall synthesis and protein function, ultimately resulting in the inhibition of microbial growth and proliferation. In terms of applications, this compound is primarily of interest within the realm of antimicrobial research. Its specific structure allows it to target and disrupt microbial components selectively, providing a valuable tool for the development of new antimicrobial agents. Given the rise of antibiotic resistance, such compounds are especially pertinent, warranting further research to fully understand their capabilities and potential therapeutic uses.Formula:C22H32O5Purity:Min. 95%Molecular weight:376.5 g/molTorilin
CAS:Torilin is an inhibitor of testosterone 5 alpha-reductase, it (IC50 = 31.7 +/- 4.23 microM) shows a stronger inhibition of 5 alpha-reductase than alpha-Formula:C22H32O5Purity:98%Color and Shape:SolidMolecular weight:376.492-Butenoic acid, 2-methyl-, (5S,6R,8S,8aR)-5-[1-(acetyloxy)-1-methylethyl]-1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-2-oxo-6-azulenyl ester, (2Z)-
CAS:Formula:C22H32O5Purity:90%Color and Shape:SolidMolecular weight:376.4865