CAS 13063-04-2: Nitidine chloride
Formula:C21H18NO4·Cl
InChI:InChI=1S/C21H18NO4.ClH/c1-22-10-13-7-17(23-2)18(24-3)8-15(13)14-5-4-12-6-19-20(26-11-25-19)9-16(12)21(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=QLDAACVSUMUMOR-UHFFFAOYSA-M
SMILES:C[N+]=1C=2C(C=3C(C1)=CC(OC)=C(OC)C3)=CC=C4C2C=C5C(=C4)OCO5.[Cl-]
Synonyms:- 2,3-Dimethoxy-12-Methyl-3,12-Dihydro[1,3]Benzodioxolo[5,6-C]Phenanthridine
- 2,3-Dimethoxy-12-Methyl[1,3]Benzodioxolo[5,6-C]Phenanthridin-12-Ium
- 2,3-Dimethoxy-12-Methyl[1,3]Benzodioxolo[5,6-C]Phenanthridin-12-Ium Chloride
- 2,3-Dimethoxy-12-methyl-(1,3)-benzodioxolo(5,6-c)phenanthridinium chloride
- Dimethoxy-12-Methyl-,Chloride
- NSC 146397
- Nitidine
- Sml 0610
- [1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl-, chloride
- [1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl-, chloride (1:1)
- [1,3]Dioxolo[4,5]benzo[1,2-c]phenanthridinium, 2,3-
- See more synonyms
Sort by
Found 9 products.
Nitidine chloride
CAS:1.Formula:C21H18ClNO4Purity:96.59% - 98.91%Color and Shape:SolidMolecular weight:383.82[1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl-, chloride (1:1)
CAS:Formula:C21H18ClNO4Purity:97%Color and Shape:SolidMolecular weight:383.8249199999999Nitidine Chloride
CAS:Controlled ProductFormula:C21H18NO4·ClColor and Shape:NeatMolecular weight:383.82Nitidine chloride
CAS:Natural alkaloidFormula:C21H18NO4ClPurity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:383.83Nitidine Chloride
CAS:Nitidine chloride has protective effects on rats during myocardial ischemia/reperfusion, it also exerts an anti-inflammatory property by inhibiting TNF-α, IL-1β, and IL-6 production in association with reduced NF-κB and MAPK signaling pathways in RAW 264.7 cells. It has inhibitory effects on various tumors, such as renal cancer , breast cancer.Formula:C21H18ClNO4Purity:95%~99%Molecular weight:383.828Nitidine chloride
CAS:Nitidine chloride is a natural alkaloid, which is isolated from the roots of Zanthoxylum nitidum. This compound functions primarily as an inhibitor of topoisomerase I and II, disrupting the replication of DNA and resulting in antitumor effects. Nitidine chloride also exhibits multiple biological activities, including anti-inflammatory, antimicrobial, and antimalarial properties. In cancer research, Nitidine chloride is extensively studied for its potential to suppress tumor growth by inducing apoptosis and inhibiting cell proliferation. Its mode of action involves the modulation of various signaling pathways, such as the NF-κB and STAT3 pathways. The compound's unique ability to target these pathways makes it a valuable candidate for developing novel anticancer therapies. Besides oncology, Nitidine chloride's antimicrobial properties have prompted investigations into its application in treating infections, further underscoring its versatile therapeutic potential.Formula:C21H18ClNO4Purity:Min. 95%Color and Shape:PowderMolecular weight:383.82 g/mol
![[1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl-, chloride (1:1)](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA000UQA.jpg&w=3840&q=75)
