CAS 13201-14-4: Dihydrocucurbitacin B
Formula:C32H48O8
InChI:InChI=1S/C32H48O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,19-22,25,34-35,39H,11-16H2,1-9H3/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1
InChI key:InChIKey=QZJJDOYZVRUEDY-NRNCYQGDSA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@](C(CCC(OC(C)=O)(C)C)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)C(=O)C4(C)C)[H])[H]
Synonyms:- Dihydrocucurbitacin B
- Cucurbitacin B, dihydro-
- (2β,9β,10α,16α)-25-(Acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanost-5-ene-3,11,22-trione
- 19-Nor-9β,10α-lanost-5-ene-3,11,22-trione, 2β,16α,20,25-tetrahydroxy-9-methyl-, 25-acetate
- 19-Norlanost-5-ene-3,11,22-trione, 25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-, (2β,9β,10α,16α)-
Sort by
Found 5 products.
Dihydrocucurbitacin B
CAS:Controlled ProductDihydrocucurbitacin B is a glycoside derivative that belongs to the class of antimicrobial agents. It has been shown to inhibit the growth of human cervical cancer cells and epidermal growth factor-induced skin cancer cells in mice. This drug also inhibits the transcriptional regulation of protein synthesis, which may be due to its ability to inhibit the activity of amino transferase and chinese herb. Dihydrocucurbitacin B has been shown to have significant cytotoxicity, which may be due to its ability to inhibit uptake and complex enzyme.Formula:C32H48O8Purity:Min. 95%Molecular weight:560.73 g/molDihydrocucurbitacin B
CAS:Dihydrocucurbitacin B (23,24-dihydrocucurbitacin B) is isolated from the roots of Cayaponia tayuya with anti-cancer activity.Formula:C32H48O8Purity:98.67%Color and Shape:SolidMolecular weight:560.72
