
CAS 132342-55-3: Methyl (2R,4aR)-1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetate
Formula:C16H24O2
InChI:InChI=1S/C16H24O2/c1-11-6-5-8-16(3)9-7-13(10-14(11)16)12(2)15(17)18-4/h13H,2,5-10H2,1,3-4H3/t13-,16-/m1/s1
InChI key:InChIKey=OWZSHJKGKHTKDS-CZUORRHYSA-N
SMILES:C[C@]12C(C[C@H](C(C(OC)=O)=C)CC1)=C(C)CCC2
Synonyms:- 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-, methyl ester, (2R-cis)-
- Methyl (2R,4aR)-1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetate
- Methyl isocostate
- Isocostic acid methyl ester
- 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-, methyl ester, (2R,4aR)-
Sort by
Found 3 products.
Methyl isocostate
CAS:Methyl isocostate is a chemical compound that is a synthetic ester, which is derived from the esterification of the corresponding hydroxyl acid. Its origin lies in the intricate processes of synthetic organic chemistry, where it serves as an intermediate or precursor in various reactions. Methyl isocostate operates through its functional ester group, which participates in nucleophilic substitution and other ester-related chemical transformations. In the realm of uses and applications, methyl isocostate finds its significance primarily in the synthesis of complex organic molecules. Its role as a precursor facilitates the creation of more elaborate chemical structures, making it valuable in both research and industrial settings. Potential applications include serving as a key reagent in the development of pharmaceuticals, agrochemicals, and polymers. Its reactivity and versatility make it an intriguing compound for scientists exploring new synthetic pathways and reaction mechanisms. Additionally, its properties might be leveraged in analytical chemistry for the development of novel probes or markers for detection and identification of specific molecular targets.Formula:C16H24O2Purity:Min. 95%Molecular weight:248.36 g/molMethyl isocostate
CAS:Methyl isocostate is a natural product for research related to life sciences. The catalog number is TN4546 and the CAS number is 132342-55-3.Formula:C16H24O2Purity:98%Color and Shape:SolidMolecular weight:248.36