
CAS 132833-03-5: 1-(isoquinolin-3-yl)methanamine dihydrochloride
Formula:C10H12Cl2N2
InChI:InChI=1/C10H10N2.2ClH/c11-6-10-5-8-3-1-2-4-9(8)7-12-10;;/h1-5,7H,6,11H2;2*1H
SMILES:c1ccc2cnc(cc2c1)CN.Cl.Cl
Sort by
Found 4 products.
Isoquinolin-3-ylmethanamine
CAS:Isoquinolin-3-ylmethanamine is an amine that can be synthesized from the reaction of an aldehyde and ammonium chloride, followed by hydroamination with an alkylating agent. The synthesis can also be achieved by reacting a primary amine with phthalimide. Isoquinolin-3-ylmethanamine has been used for the synthesis of various drugs such as antidepressants, antipsychotics, and antihypertensives. It is also used in the production of dyes and pigments. Isoquinolin-3-ylmethanamine is soluble in water and insoluble in organic solvents. The molecular weight of this compound is 165.2 g/mol.Formula:C10H10N2Purity:Min. 95%Molecular weight:158.2 g/mol