
CAS 1330286-49-1: L-Norleucine, 5-methyl-, hydrochloride (1:1)
Formula:C7H15NO2·ClH
InChI:InChI=1S/C7H15NO2.ClH/c1-5(2)3-4-6(8)7(9)10;/h5-6H,3-4,8H2,1-2H3,(H,9,10);1H/t6-;/m0./s1
InChI key:InChIKey=FQKANUHWZITUKA-RGMNGODLSA-N
SMILES:[C@H](CCC(C)C)(C(O)=O)N.Cl
Synonyms:- (2S)-2-Amino-5-methylhexanoic acid hydrochloride
- L-Norleucine, 5-methyl-, hydrochloride (1:1)
Sort by
Found 3 products.
L-Homoleucine hydrochloride
CAS:L-Homoleucine hydrochloride is a fine chemical that is used as a building block in the synthesis of complex compounds and pharmaceuticals. It has been shown to be a useful reagent in organic chemistry and can be used as a speciality chemical. L-Homoleucine hydrochloride is also a versatile building block that can be used in the synthesis of several different compounds, including pharmaceuticals, agrochemicals, and research chemicals. This compound is also an intermediate for the production of other compounds with potential clinical applications. L-Homoleucine hydrochloride belongs to CAS number 1330286-49-1.Formula:C7H15NO2·HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:181.66 g/mol