
CAS 133047-45-7: 4-Thiazolemethanol,2-(1-methylethyl)-(9CI)
Formula:C7H11NOS
InChI:InChI=1/C7H11NOS/c1-5(2)7-8-6(3-9)4-10-7/h4-5,9H,3H2,1-2H3
SMILES:CC(C)c1nc(CO)cs1
Synonyms:- (2-Isopropyl-1,3-thiazol-4-yl)methanol
- 4-Thiazolemethanol, 2-(1-methylethyl)-
- [2-(Propan-2-Yl)-1,3-Thiazol-4-Yl]Methanol
Sort by
Found 4 products.
4-Thiazolemethanol, 2-(1-methylethyl)-
CAS:Formula:C7H11NOSPurity:98%Color and Shape:LiquidMolecular weight:157.23334-(Hydroxymethyl)-2-isopropylthiazole
CAS:4-(Hydroxymethyl)-2-isopropylthiazolePurity:98%Molecular weight:157.23g/mol(2-Isopropylthiazol-4-yl)methanol
CAS:(2-Isopropylthiazol-4-yl)methanol is a chemical compound that is an organic alcohol. This molecule has two isopropyl groups attached to the thiazole ring, and one methyl group attached to the alcohol group. The hydrolysis of this molecule occurs when water molecules are added to the double bond in the molecule. The resulting products are carbon dioxide and methanol. (2-Isopropylthiazol-4-yl)methanol can be photolyzed with UV light. This will cause a reaction between the molecules, resulting in oxidation and hydroxylation of the molecules as well as cleavage of the C=S bond. (2-Isopropylthiazol-4-yl)methanol can be eluted from a column using an acidic solution or a neutral solution, depending on what other compounds are being eluted from the column at that time.Purity:Min. 95%