
CAS 13389-51-0: (3-CHLORO-PHENYL)-(4-METHOXY-PHENYL)-METHANONE
Formula:C14H11ClO2
InChI:InChI=1/C14H11ClO2/c1-17-13-7-5-10(6-8-13)14(16)11-3-2-4-12(15)9-11/h2-9H,1H3
SMILES:COc1ccc(cc1)C(=O)c1cccc(c1)Cl
Synonyms:- (3-Chlorophenyl)(4-methoxyphenyl)methanone
- Methanone, (3-chlorophenyl)(4-methoxyphenyl)-
Sort by
Found 3 products.
3-Chloro-4'-methoxybenzophenone
CAS:3-Chloro-4'-methoxybenzophenone is a versatile compound that has various applications in different industries. It is commonly used as a research chemical and can be found in proton pump inhibitors, metal complexes, and polyethylene glycol derivatives. This compound is also utilized in the production of quinoline derivatives and ubiquitin ligases. In the industrial sector, 3-Chloro-4'-methoxybenzophenone plays a crucial role as a diketone for the synthesis of other compounds. Its unique properties make it an essential ingredient in the manufacturing process of various products. With its potent characteristics, this compound has gained recognition for its efficacy and reliability. Its stability and versatility have made it a valuable asset in many industries, ensuring optimal performance and quality in diverse applications. Please note that this product description is intended for informational purposes only and should not be considered as medical or scientific advice. Always consult with professionals or experts before using any chemicals or compounds.Formula:C14H11ClO2Purity:Min. 95%Molecular weight:246.69 g/mol