CAS 134-01-0: Peonidin
Formula:C16H13O6·Cl
InChI:InChI=1S/C16H12O6.ClH/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16;/h2-7H,1H3,(H3-,17,18,19,20);1H
InChI key:InChIKey=OGBSHLKSHNAPEW-UHFFFAOYSA-N
SMILES:OC=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(OC)=C(O)C=C3.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-, chloride (1:1)
- 3,4′,5,7-Tetrahydroxy-3′-methoxy-2-phenylbenzopyrylium chloride
- 3,4′,5,7-Tetrahydroxy-3′-methoxyflavylium chloride
- 3,5,7-Trihydroxy-2-(4-Hydroxy-3-Methoxyphenyl)Chromenium Chloride
- Flavylium, 3,4′,5,7-tetrahydroxy-3′-methoxy-, chloride
- Paeonidin
- Peonidin
- Peonidin chloride
- Peonidol chloride
- Ygm 6
Sort by
Found 8 products.
Peonidin Chloride-d3
CAS:Controlled ProductFormula:C16H10D3O6•ClColor and Shape:NeatMolecular weight:339.74Peonidin chloride
CAS:Oxygen-heterocyclic compoundFormula:C16H13O6ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:336.73Peonidin chloride
CAS:Peonidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C16H13O6ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:336.73Peonidin chloride
CAS:Peonidin chloride is an anthocyanin compound commonly isolated from the plant kingdom, specifically from the vibrant pigments found in flowers like peonies and certain fruits. As a naturally occurring phenolic compound, peonidin chloride serves as a powerful antioxidant, counteracting oxidative stress by scavenging free radicals. This mode of action is crucial for studying mechanisms involved in cellular protection and signaling pathways. In scientific research, peonidin chloride is utilized for its biological activity in vitro and in vivo. Its antioxidative properties render it valuable in the exploration of metabolic and degenerative diseases, where oxidative damage plays a significant role. Additionally, peonidin chloride's role in modulating gene expression related to inflammation makes it a subject of interest in oncology and cardiovascular research. Furthermore, its pigmentation properties are employed in studies examining the impact of natural colorants in food science and technology.Formula:C16H13O6ClPurity:Min. 97 Area-%Color and Shape:Red PowderMolecular weight:336.72 g/molPeonidin chloride
CAS:Peonidin chloride has antioxidant activity.Formula:C16H13ClO6Purity:98%Color and Shape:SolidMolecular weight:336.72Peonidin Chloride
CAS:Controlled ProductFormula:C16H13O6·ClColor and Shape:NeatMolecular weight:336.72
