CAS 134-04-3: Pelargonidin chloride
Formula:C15H11O5·Cl
InChI:InChI=1S/C15H10O5.ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;/h1-7H,(H3-,16,17,18,19);1H
InChI key:InChIKey=YPVZJXMTXCOTJN-UHFFFAOYSA-N
SMILES:OC=1C2=C([O+]=C(C(O)=C2)C3=CC=C(O)C=C3)C=C(O)C1.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride (1:1)
- 3,4,5,7-Tetrahydroxyflavylium Chloride
- 3,5,7-Trihydroxy-2-(4-Hydroxyphenyl)Chromenium Chloride
- Flavylium, 3,4′,5,7-tetrahydroxy-, chloride
- Pelargonidin
- Pelargonidin Chloride
- Pelargonidol chloride
Sort by
Found 8 products.
Pelargonidin chloride
CAS:Pelargonidin chloride is a naturally occurring anthocyanidin, which is primarily sourced from various fruits and flowers, notably in plants like pelargoniums. This compound functions as a pigment, imparting a bright red coloration to plants, which plays a role in attracting pollinators and protecting the plant from environmental stressors. Its mode of action involves the stabilization of free radicals, due to its antioxidant properties, which helps in mitigating oxidative damage at the cellular level. In scientific applications, pelargonidin chloride is of significant interest due to its potential health benefits, including anti-inflammatory and anti-carcinogenic effects. It is frequently utilized in research to understand the biochemical pathways of anthocyanins and their impact on human health. Additionally, its vibrant pigmentation properties are harnessed in the food and cosmetic industries, where it acts as a natural coloring agent.Formula:C15H11ClO5Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:306.7 g/molPelargonidin chloride
CAS:Oxygen-heterocyclic compoundFormula:C15H11O5ClPurity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:306.7Pelargonidin chloride
CAS:Pelargonidin chloride protects against CTN oxidative stress in HepG2 cells by boosting detox enzymes via Keap1/Nrf2.Formula:C15H11ClO5Purity:99.02%Color and Shape:LiquidMolecular weight:306.7Pelargonidin chloride
CAS:Pelargonidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H11O5ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:306.7
