
CAS 13403-14-0: beta-D-Fructofuranoside, methyl
Formula:C7H14O6
InChI:InChI=1/C7H14O6/c1-12-7(3-9)6(11)5(10)4(2-8)13-7/h4-6,8-11H,2-3H2,1H3/t4-,5-,6+,7-/m1/s1
Synonyms:- Methylfructoside
- methyl beta-D-fructofuranoside
Sort by
Found 5 products.
Methyl β-D-fructofuranoside
CAS:Methyl beta-D-fructofuranoside is a natural product for research related to life sciences. The catalog number is TN4538 and the CAS number is 13403-14-0.Formula:C7H14O6Purity:98%Color and Shape:SolidMolecular weight:194.18Methyl b-D-fructofuranoside
CAS:Methyl b-D-fructofuranoside is a chemical compound that is used in the production of esters and fatty acids. Methyl b-D-fructofuranoside is produced by a dehydration reaction between two molecules of acetone. The product of this reaction, methyl b-D-fructopyranoside, can be broken down into two molecules of acetone and one molecule each of methyl alcohol and carbon dioxide. This process is called alkylation. Furanocoumarin derivatives are often found in plants such as asperulosidic acid and quinquefasciatus. These compounds are found in many species of plant, but they are most concentrated in the roots of these plants because they are more metabolically active there than other parts of the plant. Environmental pollution can lead to high concentrations of furanocoumarins in plants, which can have toxic effects on organisms that come into contact with them.Formula:C7H14O6Purity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:194.18 g/molMethyl β-D-fructofuranoside
CAS:Formula:C7H14O6Purity:95%~99%Color and Shape:PowderMolecular weight:194.183