
CAS 13429-07-7: 1-(2-Methoxypropoxy)-2-propanol
Formula:C7H16O3
InChI:InChI=1S/C7H16O3/c1-6(8)4-10-5-7(2)9-3/h6-8H,4-5H2,1-3H3
InChI key:InChIKey=FOLPKOWCPVGUCA-UHFFFAOYSA-N
SMILES:C(COCC(C)O)(OC)C
Synonyms:- 1-(2-Methoxypropoxy)-2-propanol
- 2-Propanol, 1-(2-methoxypropoxy)-
- Polyoxypropylene (2) methyl ether
- Polypropylene glycol (2) methyl ether
- Ai3-15574
Sort by
Found 3 products.
1-(2-Methoxypropoxy)propan-2-ol
CAS:Glycol ethers are synthetic chemicals that are used as solvents and industrial products. They are commonly used in the food industry, for example as a carrier for artificial flavours and colours. Glycol ethers can be found in many household products such as cleaners, paints, and cosmetics. Glycol ethers have been linked to various inflammatory diseases of the gastrointestinal tract. The chemical structure of glycol ethers is largely determined by the number of carbon atoms in the molecule. Monoglycol ethers contain one carbon atom, with ethylene glycol being the most common example. Ethylene glycol is also a reactive chemical that can cause cross-linking of proteins which may lead to inflammation or tissue damage.Formula:C7H16O3Purity:Min. 95%Molecular weight:148.2 g/mol