CAS 13552-72-2: Isocorydine hydrochloride
Formula:C20H23NO4·ClH
InChI:InChI=1S/C20H23NO4.ClH/c1-21-8-7-12-10-15(24-3)20(25-4)18-16(12)13(21)9-11-5-6-14(23-2)19(22)17(11)18;/h5-6,10,13,22H,7-9H2,1-4H3;1H/t13-;/m0./s1
InChI key:InChIKey=ZWSKLEMBDRWSNZ-ZOWNYOTGSA-N
SMILES:O(C)C1=C2C=3[C@](CC=4C2=C(O)C(OC)=CC4)(N(C)CCC3C=C1OC)[H].Cl
Synonyms:- 6aα-Aporphin-11-ol, 1,2,10-trimethoxy-, hydrochloride
- (+)-Isocorydine hydrochloride
- 4H-Dibenzo[de,g]quinolin-11-ol, 5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, hydrochloride, (S)-
- 4H-Dibenzo[de,g]quinolin-11-ol, 5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, hydrochloride, (6aS)-
- Isocorydine hydrochloride
- 4H-Dibenzo[de,g]quinolin-11-ol, 5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, hydrochloride (1:1), (6aS)-
Sort by
Found 6 products.
(+)-Isocorydine hydrochloride
CAS:(+)-Isocorydine hydrochloridePurity:≥98%Molecular weight:377.87g/molIsocorydine Hydrochloride
CAS:Controlled ProductFormula:C20H23NO4·ClHColor and Shape:NeatMolecular weight:377.86(+)-isocorydine hydrochloride
CAS:Natural alkaloidFormula:C20H23NO4HClPurity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:377.87(+)-Isocorydine HCl
CAS:(+)-Isocorydine HCl is an isoquinoline alkaloid derivative, which is naturally sourced from plants in the Papaveraceae family. As an alkaloid, it is notable for its structural complexity and pharmacological properties. The mode of action of (+)-Isocorydine HCl primarily involves interaction with cellular pathways that can influence apoptosis, cellular proliferation, and potentially modulate various signaling cascades. This interaction suggests its potential utility in exploring therapeutic effects, particularly related to anti-cancer research. In scientific research, (+)-Isocorydine HCl has been investigated for its role in inducing apoptosis in cancer cells, making it a subject of interest for potential development in oncological applications. Additionally, its ability to influence cellular growth pathways suggests that it could be significant in developing treatments for diseases characterized by unregulated cell proliferation. As such, it is an intriguing compound in the field of medicinal chemistry where its action mechanisms can be elucidated for potential therapeutic exploitation.Formula:C20H23NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:341.4 g/mol(+)-Isocorydine hydrochloride
CAS:(+)-Isocorydine hydrochloride (Isocorydine HCl) is a eukaryote protein kinases Inhibitor.Formula:C20H24ClNO4Purity:100% - 99.72%Color and Shape:SolidMolecular weight:377.87Ref: TM-T4291
1mg113.00€2mg170.00€5mg284.00€10mg411.00€25mg758.00€50mg1,223.00€100mg1,689.00€500mgTo inquire1mL*10mM (DMSO)304.00€
