
CAS 13570-00-8: 3-(1H-imidazol-2-yl)pyridine
Formula:C8H7N3
InChI:InChI=1/C8H7N3/c1-2-7(6-9-3-1)8-10-4-5-11-8/h1-6H,(H,10,11)
SMILES:c1cc(cnc1)c1ncc[nH]1
Synonyms:- pyridine, 3-(1H-imidazol-2-yl)-
Sort by
Found 4 products.
Pyridine, 3-(1H-imidazol-2-yl)-
CAS:Formula:C8H7N3Purity:98%Color and Shape:SolidMolecular weight:145.16133-(1H-Imidazol-2-yl)-pyridine
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:145.16499328613283-(1H-Imidazol-2-yl)pyridine
CAS:3-(1H-Imidazol-2-yl)pyridine is a pyridyl cation that can form dimers and polymers with other 3-(1H-imidazol-2-yl)pyridine molecules. The stacking of these molecules produces a two-dimensional supramolecular environment, which is shown by the interplanar coordination between the nitrogen atoms. This environment is also affected by anions in the solvent, which can coordinate with the nitrogen atoms. For example, 3-(1H-Imidazol-2-yl)pyridine forms a complex with Cl-, which has been observed to stabilize this molecule in solution.Formula:C8H7N3Purity:Min. 95%Molecular weight:145.16 g/molRef: 3D-FI130366
Discontinued product