CAS 137049-00-4: 1-methyl-1H-imidazole-4-sulfonyl chloride
Formula:C4H5ClN2O2S
InChI:InChI=1/C4H5ClN2O2S/c1-7-2-4(6-3-7)10(5,8)9/h2-3H,1H3
SMILES:Cn1cc(nc1)S(=O)(=O)Cl
Synonyms:- 1-Methylimidazole-4-Sulfonyl Chloride
Sort by
Found 5 products.
1H-Imidazole-4-sulfonyl chloride, 1-methyl-
CAS:Formula:C4H5ClN2O2SPurity:98%Color and Shape:SolidMolecular weight:180.61271-Methyl-1H-imidazole-4-sulfonyl chloride
CAS:1-Methyl-1H-imidazole-4-sulfonyl chloride is a muscle relaxant that binds to the enzyme acetylcholinesterase, which breaks down acetylcholine. It has a low oral bioavailability and the optimization of this drug for humans has been difficult due to its high binding affinity for bile acids. 1-Methyl-1H-imidazole-4-sulfonyl chloride is a diastereomeric mixture of two enantiomers, S and R. The pharmacological profiles of these two enantiomers are very different due to their different effects on the central nervous system. These differences may be related to their ability to cross the blood brain barrier.Formula:C4H5ClN2O2SPurity:Min. 95%Molecular weight:180.61 g/molRef: 3D-FM43605
Discontinued product1-Methylimidazole-4-sulfonyl chloride
CAS:Purity:98.0%Color and Shape:Solid, White to Off-WhiteMolecular weight:180.610000610351561-Methyl-1H-imidazole-4-sulphonyl chloride
CAS:1-Methyl-1H-imidazole-4-sulphonyl chlorideFormula:C4H5ClN2O2SPurity:95Color and Shape: white solidMolecular weight:180.61g/mol1-Methyl-1H-imidazole-4-sulfonyl Chloride
CAS:Controlled ProductStability Moisture Sensitive Applications 1-Methyl-1H-imidazole-4-sulfonyl chloride (cas# 137049-00-4) is a useful research chemical.Formula:C4H5ClN2O2SColor and Shape:NeatMolecular weight:180.613
