
CAS 13822-06-5: 3-METHYL-2-BUTEN-1-AMINE
Formula:C5H11N
InChI:InChI=1/C5H11N/c1-5(2)3-4-6/h3H,4,6H2,1-2H3
SMILES:CC(=CCN)C
Synonyms:- 3-Methyl-But-2-Enylamine
- 3-Methyl-2-butylene-1-amine
- 3-Methylbut-2-En-1-Amine
Sort by
Found 3 products.
3-Methyl-2-buten-1-amine
CAS:3-Methyl-2-buten-1-amine is a chemical compound that contains an amine group, a carboxylic acid group, and a double bond. It can be synthesized by the reaction of 6-chloropurine with allylamine in the presence of carbonation. 3-Methyl-2-buten-1-amine has been used in the synthesis of adenosine and pyrrolidinone. This compound also possesses physiological activities such as being able to cause parthenocarpy in plants. 3-Methyl-2-buten-1-amine cyclizes to form purines, which are nitrogenous bases found in DNA and RNA molecules.Formula:C5H11NPurity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:85.15 g/mol2-Buten-1-amine, 3-methyl-
CAS:Formula:C5H11NPurity:95%Color and Shape:LiquidMolecular weight:85.1475Ref: IN-DA0018BY
1g228.00€5gTo inquire10gTo inquire25gTo inquire50gTo inquire100gTo inquire100mg84.00€250mg118.00€