
CAS 14003-11-3: 5-Methylfuran-2-carbonyl chloride, 97%
Formula:C6H5ClO2
InChI:InChI=1/C6H5ClO2/c1-4-2-3-5(9-4)6(7)8/h2-3H,1H3
SMILES:Cc1ccc(C(=O)Cl)o1
Synonyms:- 5-Methylfuran-2-Carbonyl Chloride
Sort by
Found 3 products.
2-Furancarbonyl chloride, 5-methyl-
CAS:Formula:C6H5ClO2Purity:99%Color and Shape:SolidMolecular weight:144.55575-Methylfuran-2-Carbonyl Chloride
CAS:5-Methylfuran-2-Carbonyl ChloridePurity:99%Molecular weight:144.56g/mol5-Methyl-2-furancarbonylchloride
CAS:5-Methyl-2-furancarbonylchloride (5MFCC) is a chlorinating agent that is used in organic synthesis. It is often used as a diluent for hydrogen chloride and density lipoprotein cholesterol. 5MFCC reacts with thionyl chloride to produce pentose phosphate, which is converted to aldehydes, such as acetaldehyde or benzaldehyde. These aldehydes are further reacted with lipoproteins to form activated lipid profiles. Activated lipid profiles are used in the detection of various diseases, such as atherosclerosis and diabetes mellitus.Formula:C6H5ClO2Purity:Min. 95%Molecular weight:144.56 g/mol