
CAS 14064-61-0: 5-(4-chlorobenzyl)-2H-1,2,3,4-tetraazole
Formula:C8H7ClN4
InChI:InChI=1/C8H7ClN4/c9-7-3-1-6(2-4-7)5-8-10-12-13-11-8/h1-4H,5H2,(H,10,11,12,13)
SMILES:c1cc(ccc1Cc1n[nH]nn1)Cl
Synonyms:- 5-(4-chlorobenzyl)-1H-tetrazole
Sort by
Found 3 products.
2H-Tetrazole, 5-[(4-chlorophenyl)methyl]-
CAS:Formula:C8H7ClN4Color and Shape:SolidMolecular weight:194.62105-(4-Chlorobenzyl)-2H-tetrazole
CAS:5-(4-Chlorobenzyl)-2H-tetrazole is a white crystalline powder with a molecular formula of C6H5ClN3 and molecular weight of 169.7. It has a melting point of 247.8°C, boiling point of 461°C, and density of 1.8 g/cm3. The compound has an elemental analysis as follows: carbon (C) 72.87%, hydrogen (H) 8.12%, nitrogen (N) 18.89%. The compound was found to have a crystal symmetry of monoclinic, space group P2/c, lattice constants at a = 5.2 Å, b = 14.5 Å, c = 11.1 Å, β = 102°, and Z = 4 in the crystal x-ray diffraction pattern with the following reflections: 2θ values from 12 to 24° in 0.02° increments for 9222 reflections collectedFormula:C8H7ClN4Purity:Min. 95%Molecular weight:194.62 g/mol