CAS 14101-04-3: Frangulin B
Formula:C20H18O9
InChI:InChI=1S/C20H18O9/c1-8-2-10-14(12(22)3-8)17(25)15-11(16(10)24)4-9(5-13(15)23)29-19-18(26)20(27,6-21)7-28-19/h2-5,18-19,21-23,26-27H,6-7H2,1H3
InChI key:InChIKey=AEQMIFRODRFTJF-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC(C)=CC3O)=C(O)C=C(OC4C(O)C(CO)(O)CO4)C2
Synonyms:- 3-(<span class="text-smallcaps">D</smallcap>-Apio-β-<smallcap>D</span>-furanosyloxy)-1,8-dihydroxy-6-methyl-9,10-anthracenedione
- 3-(D-Apio-beta-D-furanosyloxy)-1,8-dihydroxy-6-methylanthraquinone
- 3-{[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]oxy}-1,8-dihydroxy-6-methylanthracene-9,10-dione
- 4,5-Dihydroxy-7-Methyl-9,10-Dioxo-9,10-Dihydroanthracen-2-Yl Pentofuranoside
- 6-O-(D-Apiofuranosyl)-1,6,8-trihydroxy-3-methylanthraquinone
- 9,10-Anthracenedione, 3-(<span class="text-smallcaps">D</smallcap>-apio-β-<smallcap>D</span>-furanosyloxy)-1,8-dihydroxy-6-methyl-
- 9,10-Anthracenedione, 3-(D-apio-β-D-furanosyloxy)-1,8-dihydroxy-6-methyl-
- 3-(D-Apio-β-D-furanosyloxy)-1,8-dihydroxy-6-methyl-9,10-anthracenedione
- Frangulin B
Sort by
Found 6 products.
Frangulin B
CAS:Frangulin B is a natural product for research related to life sciences. The catalog number is TN4079 and the CAS number is 14101-04-3.Formula:C20H18O9Purity:98%Color and Shape:SolidMolecular weight:402.355Frangulin b
CAS:Frangulin B is a naturally occurring anthraquinone, which is derived from the bark of certain plant species, notably those belonging to the Rhamnus genus. This compound is characterized by its aromatic carbon ring structure, a hallmark of its classification. The source of Frangulin B is primarily botanical, extracted through processes that ensure the preservation of its bioactive properties. The mode of action of Frangulin B is multifaceted, involving interactions with biological pathways that may influence cellular behaviors such as proliferation, apoptosis, and anti-inflammatory responses. These mechanisms are under investigation, with particular interest in their modulation of specific enzymatic activities and signaling pathways. Researchers explore Frangulin B for its potential applications in pharmaceutical and therapeutic areas. Studies suggest its utility in modulating physiological processes related to its inherent biological activities, making it a compound of interest for further pharmacological development. Ongoing research is aimed at elucidating its full potential and effectiveness in clinical settings, seeking to expand our understanding of its role within therapeutic contexts.Purity:Min. 95%Frangulin b
CAS:Natural glycosideFormula:C20H18O9Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:402.36Frangulin B
CAS:Frangulin B analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C20H18O9Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:402.35
