
CAS 14134-06-6: 9-VINYLPHENANTHRENE
Formula:C16H12
InChI:InChI=1/C16H12/c1-2-12-11-13-7-3-4-9-15(13)16-10-6-5-8-14(12)16/h2-11H,1H2
SMILES:C=Cc1cc2ccccc2c2ccccc12
Synonyms:- 9-Ethenylphenanthrene
Sort by
Found 3 products.
9-Vinylphenanthrene
CAS:Controlled ProductApplications A vinyl derivative from polynuclear aromatic hydrocarbons.Formula:C16H12Color and Shape:NeatMolecular weight:204.279-Vinylphenanthrene
CAS:9-Vinylphenanthrene is a model system for the study of carbon-carbon bond formation reactions. The reaction of anthracene with 9-vinylphenanthrene produces a mixture of products that can be used to determine the efficiency of the reaction. This reaction is called quaternization and involves the replacement of an atom or group on an organic molecule with one or more atoms or groups. The reactants are monomers, which are molecules that have double bonds in their molecular structure, and the products are polymers, which have long chains of repeating units. 9-Vinylphenanthrene has been shown to be photocatalytic in water, meaning that it uses light to decompose substances without using oxygen. This property is due to its fluorescence properties, which allow it to absorb light and emit light at longer wavelengths than those absorbed.Formula:C16H12Purity:Min. 95%Molecular weight:204.27 g/molRef: 3D-FV28707
Discontinued product