![(7E)-2-hydroxy-1-[(1E)-5-hydroxypent-1-en-1-yl]non-7-ene-3,5-diyn-1-yl 6-O-hexopyranosylhexopyrano…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F480854-7e-2-hydroxy-1-1e-5-hydroxypent-1-en-1-yl-non-7-ene-35-diyn-1-yl-6-o-hexopyranosylhexopyranoside.webp&w=3840&q=75)
CAS 142451-48-7: (7E)-2-hydroxy-1-[(1E)-5-hydroxypent-1-en-1-yl]non-7-ene-3,5-diyn-1-yl 6-O-hexopyranosylhexopyranoside
Formula:C26H38O13
InChI:InChI=1/C26H38O13/c1-2-3-4-5-7-10-15(29)16(11-8-6-9-12-27)37-26-24(35)22(33)20(31)18(39-26)14-36-25-23(34)21(32)19(30)17(13-28)38-25/h2-3,8,11,15-35H,6,9,12-14H2,1H3/b3-2+,11-8+
Synonyms:- 2-Hydroxy-1-(5-hydroxy-1-pentenyl)-7-nonene-3,5-diynyl 6-O-hexopyranosylhexopyranoside
Sort by
Found 5 products.
Lobetyolinin
CAS:Lobetyolinin is a compound from Codonopsis pilosula with acetylcholinesterase (AChE) inhibitory and antiarrhythmic activities.Formula:C26H38O13Purity:99.72%Color and Shape:SolidMolecular weight:558.57Lobetyolinin
CAS:Lobetyolinin is a natural alkaloid, which is a bioactive compound extracted from certain plant species, particularly those belonging to the Lobelia genus. Alkaloids are known for their diverse pharmacological effects and are sourced primarily from plant materials. In terms of mode of action, lobetyolinin functions by interacting with specific receptors and signaling pathways within biological systems, which can lead to a range of physiological responses. Lobetyolinin has been studied for its potential therapeutic applications, especially in the fields of neurology and respiratory medicine. Preliminary research suggests that it may possess beneficial properties such as anti-inflammatory and bronchodilatory effects, which could be useful in treating conditions like asthma or other respiratory disorders. Further studies are required to fully understand its mechanisms and to evaluate the scope of its clinical applications. As scientists advance research in this area, lobetyolinin continues to present itself as a compound of interest due to its unique chemical properties and potential medical benefits.Formula:C26H38O13Purity:Min. 95%Molecular weight:558.6 g/mol