
CAS 142561-10-2: Glyasperin D
Formula:C22H26O5
InChI:InChI=1S/C22H26O5/c1-13(2)5-7-17-20(25-3)11-21-18(22(17)26-4)9-14(12-27-21)16-8-6-15(23)10-19(16)24/h5-6,8,10-11,14,23-24H,7,9,12H2,1-4H3/t14-/m0/s1
InChI key:InChIKey=DDMAUIOCNQXFHL-AWEZNQCLSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1CC=C(C)C)OC[C@H](C2)C3=C(O)C=C(O)C=C3
Synonyms:- 1,3-Benzenediol, 4-[(3R)-3,4-dihydro-5,7-dimethoxy-6-(3-methyl-2-butenyl)-2H-1-benzopyran-3-yl]-
- 1,3-Benzenediol, 4-[(3R)-3,4-dihydro-5,7-dimethoxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-3-yl]-
- Glyasperin D
- 1,3-Benzenediol, 4-[3,4-dihydro-5,7-dimethoxy-6-(3-methyl-2-butenyl)-2H-1-benzopyran-3-yl]-, (R)-
- 4-[(3R)-3,4-Dihydro-5,7-dimethoxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-3-yl]-1,3-benzenediol
Sort by
Found 4 products.
Glyasperin D
CAS:Glyasperin D is a flavonoid compound extracted from the root of Glycyrrhiza uralensis, which has potential antimicrobial activity against Helicobacter pylori.Formula:C22H26O5Purity:98%Color and Shape:SolidMolecular weight:370.44Glyasperin D
CAS:Glyasperin D is a synthetic compound, which is a structurally engineered molecule designed to interfere with specific bacterial biosynthetic pathways. It originates from a laboratory synthesis that utilizes advanced organic chemistry techniques to create a stable and potent molecular structure with antimicrobial properties. The mode of action involves the targeted inhibition of key enzymes in bacterial metabolism, disrupting essential cellular processes and leading to the reduction of bacterial growth or elimination of pathogenic bacteria. Glyasperin D is primarily utilized in microbiological research to study bacterial resistance mechanisms and potential therapeutic approaches. Its application in experimental settings allows for the exploration of its efficacy and specificity, offering insights into alternative treatments for bacterial infections. This compound is also instrumental in understanding enzyme targeting within microbial metabolic pathways, paving the way for innovation in antibiotic development.Formula:C22H26O5Purity:Min. 95%Molecular weight:370.4 g/mol