CAS 142796-22-3: Isosilybin B
Formula:C25H22O10
InChI:InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-18-7-12(3-5-16(18)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20-,23-,24-,25+/m0/s1
InChI key:InChIKey=FDQAOULAVFHKBX-WAABAYLZSA-N
SMILES:C(O)[C@H]1[C@@H](OC=2C(O1)=CC(=CC2)[C@H]3OC=4C(C(=O)[C@@H]3O)=C(O)C=C(O)C4)C5=CC(OC)=C(O)C=C5
Synonyms:- Silybin a2
- Isosilybin B
- 4H-1-Benzopyran-4-one, 2-[(2S,3S)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-
- (2R,3R)-2-[(2S,3S)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
- 1,4-Benzodioxin, 4H-1-benzopyran-4-one deriv.
Sort by
Found 8 products.
Isosilybin B
CAS:Isosilybin B, from silymarin, hinders PCA, stops cell growth, causes G1 arrest and apoptosis, and breaks down androgen receptors.Formula:C25H22O10Purity:100%Color and Shape:SolidMolecular weight:482.44Isosilybin b
CAS:Oxygen-heterocyclic compoundFormula:C25H22O10Purity:≥ 80.0 % (HPLC)Color and Shape:PowderMolecular weight:482.44Isosilybin B
CAS:Isosilybin B is an active component of silymarin, which is a complex of flavonolignans derived from the seeds of the milk thistle plant, *Silybum marianum*. This compound is characterized as a powerful antioxidant, functioning through scavenging free radicals and modulating enzymatic activities involved in oxidative stress pathways. Isosilybin B distinguishes itself by influencing cell signaling pathways and gene expression, thereby exerting cellular protective effects, which make it particularly interesting for research in hepatoprotection and chemoprevention. Isosilybin B has been extensively studied for its potential uses in therapeutic contexts, particularly concerning liver health. The compound’s ability to modulate oxidative stress and inflammation makes it a candidate for preventing liver damage induced by toxins or metabolic disorders. Additionally, its role in modulating cellular signaling pathways has sparked interest in its application as an adjunct in cancer therapy studies, particularly in the context of prostate cancer. Its complex molecular interactions and bioavailability challenges present a compelling area for ongoing research, targeting bioactivity optimization and therapeutic efficacy.Formula:C25H22O10Purity:Min. 95%Molecular weight:482.44 g/mol
