
CAS 1431-40-9: 2-methylsulfanylpyrimidine-4,5,6-triamine
Formula:C5H9N5S
InChI:InChI=1/C5H9N5S/c1-11-5-9-3(7)2(6)4(8)10-5/h6H2,1H3,(H4,7,8,9,10)
SMILES:CSc1nc(c(c(=N)[nH]1)N)N
Synonyms:- 4,5,6-Triamino-2-(Methylsulfanyl)Pyrimidine
Sort by
Found 3 products.
2-methylsulfanylpyrimidine-4,5,6-triamine
CAS:Formula:C5H9N5SPurity:97%Color and Shape:SolidMolecular weight:171.22352-(Methylthio)pyrimidine-4,5,6-triamine
CAS:2-(Methylthio)pyrimidine-4,5,6-triamine is a centrosymmetric molecule with a molecular weight of 184.07 g/mol. It forms hydrogen bonds with water and interacts with other molecules. 2-(Methylthio)pyrimidine-4,5,6-triamine has been shown to form stacking interactions in crystal structures due to the presence of hydrogen bonds. Hydrogen bonds are formed between molecules when the partial positive charge on one molecule is attracted to the partial negative charge on another molecule. The attraction between these molecules can be facilitated by the presence of water molecules and is most prevalent in substances that have a high degree of hydrogen bonding potential, such as sugars and proteins. 2-(Methylthio)pyrimidine-4,5,6-triamine has also been shown to form hydrogen bonds with organic compounds such as methanol and ethanol.Formula:C5H9N5SPurity:Min. 95%Molecular weight:171.22 g/mol