![4,9-Dihydroxy-7H-furo[3,2-g][1]benzopyran-7-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F256511-49-dihydroxy-7h-furo-32-g-1-benzopyran-7-one.webp&w=3840&q=75)
CAS 14348-23-3: 4,9-Dihydroxy-7H-furo[3,2-g][1]benzopyran-7-one
Formula:C11H6O5
InChI:InChI=1S/C11H6O5/c12-7-2-1-5-8(13)6-3-4-15-10(6)9(14)11(5)16-7/h1-4,13-14H
InChI key:InChIKey=DZEPISXWRUMGFN-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(O)=C3C1OC=C3)C=CC(=O)O2
Synonyms:- 4,9-Dihydroxy-7H-furo[3,2-g][1]benzopyran-7-one
- 5,8-Dihydroxypsoralen
- 7H-Furo(3,2-g)(1)benzopyran-7-one, 4,9-dihydroxy-
- Psoralen, 5,8-dihydroxy-
Sort by
Found 4 products.
5,8-Dihydroxypsoralen
CAS:5,8-Dihydroxypsoralen is a natural product from Pueraria lobata (Willd.) OhwiFormula:C11H6O5Purity:98%Color and Shape:SolidMolecular weight:218.165,8-Dihydroxypsoralen
CAS:5,8-Dihydroxypsoralen is a naturally occurring furanocoumarin compound, which is a secondary metabolite sourced from various plant species, such as those within the genera *Ammi* and *Citrus*. Its mode of action involves intercalating into DNA and forming covalent bonds upon exposure to ultraviolet A (UVA) light. This interaction results in DNA cross-linking, which inhibits DNA synthesis and cellular proliferation. 5,8-Dihydroxypsoralen is primarily used in the field of dermatology, particularly in photochemotherapy (PUVA therapy), to treat skin conditions such as psoriasis, vitiligo, and eczema. The compound’s ability to alter DNA processes makes it effective in mitigating the rapid cell division associated with these skin disorders. By regulating hyperproliferation of keratinocytes, it assists in reducing symptoms and promoting normal skin function. Though powerful, its use requires careful dosage and administration, due to the potential for phototoxicity and other side effects. Its application underscores important therapeutic dynamics within dermatology and photomedicine.Formula:C11H6O5Purity:Min. 95%Molecular weight:218.16 g/mol5,8-Dihydroxypsoralen
CAS:Controlled ProductFormula:C11H6O5Color and Shape:NeatMolecular weight:218.162