
CAS 143601-09-6: curculigoside B
Formula:C21H24O11
InChI:InChI=1/C21H24O11/c1-29-14-4-2-3-12(24)16(14)20(28)30-9-10-7-11(23)5-6-13(10)31-21-19(27)18(26)17(25)15(8-22)32-21/h2-7,15,17-19,21-27H,8-9H2,1H3/t15-,17-,18-,19-,21-/m1/s1
Synonyms:- 2-(beta-D-allopyranosyloxy)-5-hydroxybenzyl 2-hydroxy-6-methoxybenzoate
Sort by
Found 5 products.
Curculigoside B
CAS:Curculigoside B shows antioxidative and antiosteoporotic activities, it can decrease area of bone resorption pit, osteoclastic formation and TRAP activity.Formula:C21H24O11Color and Shape:SolidMolecular weight:452.41Curculigoside B
CAS:Natural phenol with activity against β-amyloid aggregationFormula:C21H24O11Purity:Min. 95%Color and Shape:PowderMolecular weight:452.41 g/mol