
CAS 1460-05-5: (4-NITRO-PHENYL)-ACETALDEHYDE
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,6H,5H2
SMILES:c1cc(ccc1CC=O)N(=O)=O
Synonyms:- 2-(4-Nitrophenyl)Acetaldehyde
Sort by
Found 3 products.
(4-Nitrophenyl)acetaldehyde
CAS:4-Nitrophenylacetaldehyde is an organic compound that belongs to the group of reactive chemicals. It is synthetically derived from nitrobenzene and reacts with proton, covalent adducts, or other functional groups. 4-Nitrophenylacetaldehyde has been shown to be a target for cancer research because it can be used to produce cancer drugs by linking a variety of functional groups to the molecule. The nitrogen atom in the molecule is also a target for research because it can be converted into nitro groups and can help in the development of new drugs through dehydration reactions.Formula:C8H7NO3Purity:Min. 95%Molecular weight:165.15 g/mol