
CAS 14685-06-4: pranferol
Formula:C16H16O5
InChI:InChI=1/C16H16O5/c1-9(2)12(17)8-20-16-10-3-4-15(18)21-14(10)7-13-11(16)5-6-19-13/h3-7,9,12,17H,8H2,1-2H3/t12-/m0/s1
SMILES:CC(C)[C@H](COc1c2ccc(=O)oc2cc2c1cco2)O
Synonyms:- 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-(2-hydroxy-3-methylbutoxy)-, (-)-
- 4-{[(2R)-2-hydroxy-3-methylbutyl]oxy}-7H-furo[3,2-g]chromen-7-one
- Pranferol
Sort by
Found 2 products.
Pranferol
CAS:Pranferol is a phytochemical compound, which is derived from natural plant sources. It possesses unique immunomodulatory properties, affecting cellular pathways that regulate immune responses. The bioactive components in Pranferol interact with specific receptors on immune cells, modulating signaling cascades and gene expression to enhance or suppress specific immune functions depending on the physiological context. Extensive research on Pranferol has demonstrated its potential in various therapeutic applications, particularly in the modulation of immune-related disorders. It may contribute to balancing immune responses in autoimmune diseases, reducing inflammation, and enhancing the efficacy of vaccines by acting as an adjuvant. Further studies are warranted to explore its role in oncology as it may influence tumor microenvironment and immune cell infiltration. This distinctive profile of Pranferol makes it a promising candidate for the development of new therapeutic strategies aimed at immune system regulation.Formula:C16H16O5Purity:Min. 95%Molecular weight:288.3 g/mol7H-Furo[3,2-g][1]benzopyran-7-one, 4-[(2R)-2-hydroxy-3-methylbutoxy]-
CAS:Formula:C16H16O5Molecular weight:288.2952