CAS 147419-93-0: b-D-Glucopyranoside, (3b,6a,12b)-3,12-dihydroxydammara-20,24-dien-6-yl 2-O-(6-deoxy-a-L-mannopyranosyl)-
Formula:C42H70O12
InChI:InChI=1S/C42H70O12/c1-20(2)11-10-12-21(3)23-13-16-41(8)29(23)24(44)17-27-40(7)15-14-28(45)39(5,6)36(40)25(18-42(27,41)9)52-38-35(33(49)31(47)26(19-43)53-38)54-37-34(50)32(48)30(46)22(4)51-37/h11,22-38,43-50H,3,10,12-19H2,1-2,4-9H3/t22-,23+,24+,25-,26+,27+,28-,29-,30-,31+,32+,33-,34+,35+,36-,37-,38+,40+,41+,42+/m0/s1
InChI key:InChIKey=ZVTVWDXRNMHGNY-JOGTXEPTSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@H](C(CCC=C(C)C)=C)CC3)([C@H](O)C[C@@]1([C@]4(C)[C@@]([C@@H](O[C@H]5[C@H](O[C@H]6[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O)[C@@H](CO)O5)C2)(C(C)(C)[C@@H](O)CC4)[H])[H])[H]
Synonyms:- (3β,6α,12β)-3,12-Dihydroxydammara-20,24-dien-6-yl 2-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranoside
- D-20(21)-Ginsenoside Rg6
- Ginsenoside Rg6
- Ginsenoside Rg<sub>6</sub>
- GinsenosideRg6
- Δ-20(21)-Ginsenoside Rg<sub>6</sub>
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (3β,6α,12β)-3,12-dihydroxydammara-20,24-dien-6-yl 2-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-
- β-D-Glucopyranoside, (3β,6α,12β)-3,12-dihydroxydammara-20,24-dien-6-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-
- (3β,6α,12β)-3,12-Dihydroxydammara-20,24-dien-6-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside
Sort by
Found 6 products.
Ginsenoside Rg6
CAS:Ginsenoside Rg6 inhibits the proliferation and induces apoptosis of human lymphoma JK cellsFormula:C42H70O12Purity:≥98%Color and Shape:SolidMolecular weight:767Ginsenoside Rg6
CAS:Ginsenoside Rg6 is a saponin compound, which is a naturally occurring glycoside found in the plant species Panax ginseng. Ginsenosides are the active pharmacological components of ginseng, recognized for their diverse bioactive properties. Ginsenoside Rg6 specifically acts by modulating multiple signaling pathways, exhibiting effects such as anti-inflammatory and antioxidant actions. It interacts with cellular mechanisms to inhibit the production of pro-inflammatory cytokines and reactive oxygen species. The compound is primarily researched for its potential therapeutic applications in managing conditions associated with inflammation and oxidative stress. Ginsenoside Rg6 has been shown to influence pathways related to immune response modulation and cell signaling, making it a subject of interest in studies focused on chronic inflammatory diseases and cancer. Furthermore, it is explored for its neuroprotective properties, suggesting potential benefits in neurodegenerative disorders. Overall, Ginsenoside Rg6 continues to attract scientific interest for its multifaceted biological activities and potential as a therapeutic agent in various medical fields.Formula:C42H70O12Purity:Min. 95%Color and Shape:White PowderMolecular weight:767 g/mol
