
CAS 1482-74-2: 2',3',4'-TRIHYDROXYCHALCONE
Formula:C15H12O4
InChI:InChI=1/C15H12O4/c16-12(8-6-10-4-2-1-3-5-10)11-7-9-13(17)15(19)14(11)18/h1-9,17-19H/b8-6+
Synonyms:- Akos 214-29
- (2E)-3-phenyl-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one
Sort by
Found 3 products.
2-Propen-1-one, 3-phenyl-1-(2,3,4-trihydroxyphenyl)-
CAS:Formula:C15H12O4Purity:95%Molecular weight:256.25342',3',4'-Trihydroxychalcone
CAS:2',3',4'-Trihydroxychalcone is a naturally occurring chalcone, which is a type of polyphenolic compound. It is typically derived from various plant sources, particularly those belonging to the Fabaceae family. This compound exerts its biological effects primarily through its mode of action as an antioxidant. It achieves this by scavenging free radicals, thereby reducing oxidative stress and protecting cells from damage. In scientific research, 2',3',4'-Trihydroxychalcone is extensively studied for its potential therapeutic benefits. Its antioxidant activity makes it a candidate for investigation in areas such as neuroprotection, cardioprotection, and anti-inflammatory responses. Additionally, its ability to modulate signaling pathways adds to its potential in cancer research. The compound’s efficacy in influencing cellular pathways suggests its usefulness in developing new pharmacological interventions. Researchers often explore its applications in the formulation of nutraceuticals and its integration into treatment regimens aimed at mitigating oxidative damage and associated pathologies.Formula:C15H12O4Purity:Min. 95%Molecular weight:256.25 g/mol