
CAS 1483-24-5: Benzoic acid, 1-methylhydrazide (6CI,7CI,8CI,9CI)
Formula:C8H10N2O
InChI:InChI=1/C8H10N2O/c1-10(9)8(11)7-5-3-2-4-6-7/h2-6H,9H2,1H3
SMILES:CN(C(=O)c1ccccc1)N
Synonyms:- N-methylbenzohydrazide
Sort by
Found 3 products.
N-Methylbenzohydrazide
CAS:N-MethylbenzohydrazideFormula:C8H10N2OPurity:techColor and Shape: light yellow liquidMolecular weight:150.18g/molN-Methylbenzohydrazide
CAS:N-Methylbenzohydrazide is an isomeric compound that contains a hydroxy group and a cyclic structure. It has been shown to inhibit the growth of bacteria by binding to their cell walls. N-Methylbenzohydrazide has been shown to be effective against methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens, although is not active against acid-fast bacteria such as Mycobacterium tuberculosis or Mycobacterium avium complex. N-Methylbenzohydrazide has also been shown to be an antibacterial agent that inhibits the growth of Gram-positive organisms by binding to their cell walls. The chemical reaction between the hydroxyl group and the chloride in this compound forms a dipole, which can lead to an antibacterial effect. This compound is typically used as an intermediate for other compounds.Formula:C8H10N2OPurity:Min. 95%Molecular weight:150.18 g/molBenzoic acid, 1-methylhydrazide (6CI,7CI,8CI,9CI)
CAS:Formula:C8H10N2OPurity:97%Color and Shape:SolidMolecular weight:150.1778