
CAS 148672-15-5: N-[4-Methoxy-3-(4-methyl-1-piperazinyl)phenyl]-2′-methyl-4′-(5-methyl-1,3,4-oxadiazol-2-yl)[1,1′-biphenyl]-4-carboxamide
Formula:C29H31N5O3
InChI:InChI=1S/C29H31N5O3/c1-19-17-23(29-32-31-20(2)37-29)9-11-25(19)21-5-7-22(8-6-21)28(35)30-24-10-12-27(36-4)26(18-24)34-15-13-33(3)14-16-34/h5-12,17-18H,13-16H2,1-4H3,(H,30,35)
InChI key:InChIKey=QXLNAYIFEMXTDZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(NC(=O)C2=CC=C(C=C2)C3=C(C)C=C(C=C3)C=4OC(C)=NN4)C=C1)N5CCN(C)CC5
Synonyms:- [1,1′-Biphenyl]-4-carboxamide, N-[4-methoxy-3-(4-methyl-1-piperazinyl)phenyl]-2′-methyl-4′-(5-methyl-1,3,4-oxadiazol-2-yl)-
- N-[4-Methoxy-3-(4-methyl-1-piperazinyl)phenyl]-2′-methyl-4′-(5-methyl-1,3,4-oxadiazol-2-yl)[1,1′-biphenyl]-4-carboxamide
Sort by
Found 1 products.
GMC 2-29
CAS:GMC 2-29 is a broad-spectrum fungicide, which is derived from chemical synthesis with systemic properties. As a product of chemico-biological research, it is engineered to inhibit fungal growth by interfering with essential cellular processes within target pathogens. Its active ingredients penetrate plant tissues, providing efficient internal protection against a range of fungal diseases. This fungicide is used principally in agricultural practices, particularly in the cultivation of crops vulnerable to fungal infections. By integrating GMC 2-29 into crop management regimens, it plays a pivotal role in maintaining plant health and ensuring higher yields. The systemic nature ensures that the active compounds are transported throughout the plant, thus offering comprehensive defense and reducing the need for frequent applications. Additionally, its formulation allows it to remain effective across various environmental conditions, making it a versatile tool in integrated pest management strategies.Formula:C27H30N4O3Purity:Min. 95%Molecular weight:458.6 g/mol