![N-[4-(Aminosulfonyl)phenyl]-2-chloroacetamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F142664-n-4-aminosulfonyl-phenyl-2-chloroacetamide.webp&w=3840&q=75)
CAS 14949-01-0: N-[4-(Aminosulfonyl)phenyl]-2-chloroacetamide
Formula:C8H9ClN2O3S
InChI:InChI=1S/C8H9ClN2O3S/c9-5-8(12)11-6-1-3-7(4-2-6)15(10,13)14/h1-4H,5H2,(H,11,12)(H2,10,13,14)
InChI key:InChIKey=WBDDNKFSVVIFOG-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC=C(NC(CCl)=O)C=C1
Synonyms:- 2-Chloro-N-(4-sulfamoylphenyl)acetamide
- Acetamide, N-[4-(aminosulfonyl)phenyl]-2-chloro-
- Acetanilide, 2-chloro-4′-sulfamoyl-
- N-[4-(Aminosulfonyl)phenyl]-2-chloroacetamide
- N<sup>4</sup>-Chloracetylsulfanilamide
- NSC 525660
- N4-Chloracetylsulfanilamide
Sort by
Found 3 products.
2-Chloro-N-(sulfamoylphenyl)acetamide
CAS:Purity:95.0%Color and Shape:Solid, CrystallineMolecular weight:248.67999267578125n-[4-(aminosulfonyl)phenyl]-2-chloroacetamide
CAS:N-[4-(aminosulfonyl)phenyl]-2-chloroacetamide is a benzene derivative with amido, amide, and carbonyl functional groups. The molecule has an intramolecular hydrogen bond that stabilizes the molecule and allows it to bind to the disordered region of the crystal structure. This interaction also occurs between two molecules in the intermolecular space, which stabilizes the molecule by contributing to its dihedral angle. The benzene ring is stabilized by hydrogen bonds and interactions with other factors such as carbonyl groups and carbonyl groups. 3-Indoxyl-beta-D-galactopyranoside Rifapentine Tilmicosin 3-Desacetylcefotaxime potassium GatifloxacinFormula:C8H9ClN2O3SPurity:Min. 95%Molecular weight:248.69 g/molAcetamide, N-[4-(aminosulfonyl)phenyl]-2-chloro-
CAS:Formula:C8H9ClN2O3SColor and Shape:SolidMolecular weight:248.6867