
CAS 149849-92-3: 2-Chloropyrimidine-4-carboxylic acid
Formula:C5H3ClN2O2
InChI:InChI=1/C5H3ClN2O2/c6-5-7-2-1-3(8-5)4(9)10/h1-2H,(H,9,10)
SMILES:c1cnc(Cl)nc1C(=O)O
Synonyms:- 2-Chloropyrimidine-4-carboxylicacid
- 4-Pyrimidinecarboxylic acid, 2-chloro-
- Acide 2-Chloropyrimidine-4-Carboxylique
Sort by
Found 4 products.
2-Chloropyrimidine-4-carboxylic acid
CAS:2-Chloropyrimidine-4-carboxylic acid is a halogenated amino acid derivative. It inhibits the growth of microorganisms by causing DNA damage and has been used as an antimicrobial agent in microbiological studies. 2-Chloropyrimidine-4-carboxylic acid has been shown to inhibit the growth of bacteria that are resistant to other antibiotics, such as methicillin or erythromycin. This drug has a low therapeutic index, which means that it can be toxic if given in high doses.Formula:C5H3CIN2O2Purity:Min. 95%Molecular weight:262 g/molRef: 3D-FC32666
Discontinued product2-Chloropyrimidine-4-Carboxylic Acid
CAS:Formula:C5H3ClN2O2Purity:98%Color and Shape:SolidMolecular weight:158.54252-Chloropyrimidine-4-carboxylic acid
CAS:2-Chloropyrimidine-4-carboxylic acidFormula:C5H3ClN2O2Purity:96% (nmr) (Typical Value in Batch COA)Color and Shape: yellow solidMolecular weight:158.54g/mol2-Chloropyrimidine-4-carboxylic acid
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:158.5399932861328