
CAS 15069-44-0: 1,6-Dimethoxy-9H-xanthen-9-one
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c1-17-9-6-7-10-13(8-9)19-12-5-3-4-11(18-2)14(12)15(10)16/h3-8H,1-2H3
InChI key:InChIKey=YVUNOTJSPXOLEZ-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C1=CC=C(OC)C3)=CC=CC2OC
Synonyms:- 1,6-Dimethoxy-9H-xanthen-9-one
- 9H-Xanthen-9-one, 1,6-dimethoxy-
- 1,6-Dimethoxyxanthone
- Xanthen-9-one, 1,6-dimethoxy-
Sort by
Found 1 products.
3,8-Dimethoxyxanthone
CAS:3,8-Dimethoxyxanthone is an organic compound, which is a type of xanthone derivative. It is primarily sourced from natural plant extracts, particularly those found in certain tropical and subtropical regions. This compound is synthesized via the oxidative coupling of phenolic precursors and subsequent methylation, a process leveraged due to its presence in various plant species. 3,8-Dimethoxyxanthone exhibits multiple modes of action, including potential antioxidant, anti-inflammatory, and cytotoxic activities. At the cellular level, it may interact with enzymatic pathways, modulating oxidative stress responses and attenuating inflammatory mediators, thereby highlighting its pharmacological versatility. In scientific research, 3,8-Dimethoxyxanthone is primarily investigated for its potential therapeutic applications in treating conditions like cancer and inflammatory diseases. Researchers are particularly interested in its ability to induce apoptosis in cancer cells and its role in minimizing inflammation through molecular pathway modulation. As a subject of pharmacological studies, this compound continues to garner interest for its potential efficacy and safety in preclinical and clinical settings.Formula:C15H12O4Purity:Min. 95%Molecular weight:256.25 g/mol