4-Chloro-3-nitrophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains both a chlorine and a nitro substituent. This compound typically appears as a solid and is soluble in polar solvents, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, which are pivotal in the synthesis of biaryl compounds. The presence of the chloro and nitro groups on the aromatic ring can influence its reactivity and selectivity in organic synthesis. Additionally, the boronic acid moiety allows for the formation of stable complexes with diols, which is significant in applications such as drug development and materials science. The compound is often handled with care due to its potential reactivity and the need for proper safety protocols in laboratory settings. Overall, 4-Chloro-3-nitrophenylboronic acid serves as a valuable intermediate in organic synthesis and medicinal chemistry.

4-Chloro-3-nitrophenylboronic acid

151169-67-4: 4-Chloro-3-nitrobenzeneboronic acid, Akos Brn-0709, 4-Chloro-3-Nitrophenylboronic, 4-CHLORO-5-nitrophenylboronic acid, 3-Nitro-4-chlorophenylboronic acid, 4-Chloro-3-nitrobenzeneboronicacid

4-Chloro-3-nitrophenylboronic Acid (contains varying amounts of Anhydride)

3-Nitro-4-chlorophenylboronic acid

4-Chloro-3-nitrobenzeneboronic acid

4-Chloro-3-nitrophenylboronic acid is an antiviral agent that inhibits the replication of viruses. It has been shown to inhibit the replication of hepatitis B virus and HIV, but not influenza A virus.

CAS 151169-67-4: 4-Chloro-3-nitrophenylboronic acid

4-Chloro-3-nitrophenylboronic acid

Ref: 7W-GK8074

4-Chloro-3-nitrophenylboronic Acid (contains varying amounts of Anhydride)

Ref: 3B-C3212

3-Nitro-4-chlorophenylboronic acid

Ref: 10-F093189

4-Chloro-3-nitrobenzeneboronic acid

Ref: 54-OR13107

4-Chloro-3-nitrophenylboronic acid

Ref: 3D-FC36777

Boronic acid, B-(4-chloro-3-nitrophenyl)-

Ref: IN-DA001N57