CAS 1524-40-9: 3-FLUOROBENZENESULFONAMIDE
Formula:C6H6FNO2S
InChI:InChI=1/C6H6FNO2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,(H2,8,9,10)
SMILES:c1cc(cc(c1)S(=O)(=O)N)F
Synonyms:- 3-Fluorobenzenesulphonamide
- Buttpark 33\11-50
- Benzenesulfonamide, 3-fluoro- (9CI)
Sort by
Found 5 products.
3-Fluorobenzenesulfonamide
CAS:Formula:C6H6FNO2SPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:175.183-fluorobenzenesulfonamide
CAS:3-fluorobenzenesulfonamide is a sulfonamide that has been shown to be an effective weight loss drug. It inhibits the production of lipoprotein lipase, which is an enzyme that hydrolyzes triglycerides into free fatty acids and glycerol. 3-fluorobenzenesulfonamide also inhibits the synthesis of adipose tissue by inhibiting the growth rate of cells in culture. The compound was found to inhibit the transport rate of glucose from blood to muscle tissue, leading to a decrease in body mass index (BMI) and increased frequency of glucose transport. 3-fluorobenzenesulfonamide's effects on glucose transport are controlled by an actuator that measures changes in pH levels in the body and sends a signal to the control system when it detects changes in pH. This actuator is connected to a sensor, which measures acidity levels through electrical conductivity. The control system then alters the concentration of 3-fluFormula:C6H6FNO2SPurity:Min. 95%Molecular weight:175.18 g/mol3-Fluorobenzenesulphonamide
CAS:3-FluorobenzenesulphonamideFormula:C6H6FNO2SPurity:97%Color and Shape: solidMolecular weight:175.18g/mol3-Fluorobenzenesulfonamide
CAS:Formula:C6H6FNO2SPurity:97%Color and Shape:SolidMolecular weight:175.1807
