
CAS 15291-78-8: Ginkgolide M
Formula:C20H24O10
InChI:InChI=1S/C20H24O10/c1-5-6-8(27-13(5)24)10(22)19-12-7(21)9(17(2,3)4)18(19)11(23)14(25)29-16(18)30-20(6,19)15(26)28-12/h5-12,16,21-23H,1-4H3/t5-,6-,7+,8+,9-,10+,11-,12+,16-,18-,19+,20?/m0/s1
InChI key:InChIKey=KDKROYXEHCYLJQ-SVTJGRNLSA-N
SMILES:O[C@H]1[C@@]23[C@@]45[C@](OC2([C@@]6([C@]1(OC(=O)[C@H]6C)[H])[H])C(=O)O[C@@]3([C@H](O)[C@H]4C(C)(C)C)[H])(OC(=O)[C@@H]5O)[H]
Synonyms:- Ginkgolide A, 3-deoxy-1,7-dihydroxy-, (1α,7β)-
- 5H-Dicyclopenta[b,c]furan-3,5a(6H)-diacetic acid, 6-tert-butyl-3a-carboxyhexahydro-α5a,1,2,5,7,8-hexahydroxy-α3-methyl-, tri-γ-lactone
- 9H-1,7a-(Epoxymethano)-1H,6aH-cyclopenta[c]furo[2,3-b]furo[3′,2′:3,4]cyclopenta[1,2-d]furan-5,9,12(4H)-trione, 3-tert-butylhexahydro-2,4,11-trihydroxy-8-methyl-
- 9H-1,7a-(Epoxymethano)-1H,6aH-cyclopenta[c]furo[2,3-b]furo[3′,2′:3,4]cyclopenta[1,2-d]furan-5,9,12(4H)-trione, 3-(1,1-dimethylethyl)hexahydro-2,4,11-trihydroxy-8-methyl-, (1S,2R,3S,3aS,4R,6aR,7aR,7bR,8S,10aS,11R,11aS)-
- (1S,2R,3S,3aS,4R,6aR,7aR,7bR,8S,10aS,11R,11aS)-3-(1,1-Dimethylethyl)hexahydro-2,4,11-trihydroxy-8-methyl-9H-1,7a-(epoxymethano)-1H,6aH-cyclopenta[c]furo[2,3-b]furo[3′,2′:3,4]cyclopenta[1,2-d]furan-5,9,12(4H)-trione
Sort by
Found 2 products.
Ginkgolide M
CAS:Ginkgolide M is a diterpenoid trilactone, which is a natural compound derived from the leaves of the Ginkgo biloba tree. Ginkgo biloba is an ancient plant species known for its resilient nature and traditional medicinal use. The mode of action of Ginkgolide M involves antagonism of platelet-activating factor (PAF) receptors. By this mechanism, it influences various biological processes such as platelet aggregation and inflammation, which are critical pathways in numerous physiological and pathological states. The uses and applications of Ginkgolide M are primarily focused on its potential therapeutic effects, particularly in cardiovascular and neurological contexts. It has been investigated for its ability to modulate blood flow, reduce the risk of thrombosis, and act as an anti-inflammatory agent. Additionally, due to its ability to cross the blood-brain barrier, Ginkgolide M has been studied for neuroprotective roles, including the treatment and prevention of disorders such as stroke and dementia. Its unique biochemical properties make Ginkgolide M a subject of ongoing research in the exploration of novel therapeutic avenues.Formula:C20H24O10Purity:Min. 95%Molecular weight:424.4 g/mol