
CAS 153403-53-3: 2-Chloro-6-fluorobenzoxazole
Formula:C7H3ClFNO
InChI:InChI=1S/C7H3ClFNO/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3H
InChI key:InChIKey=SABSNTHFVVOJMX-UHFFFAOYSA-N
SMILES:ClC1=NC=2C(O1)=CC(F)=CC2
Synonyms:- 2-Chloro-5-Fluoro-1,3-Benzoxazole
- 2-Chloro-5-Fluorobenzo[D]Oxazole
- 2-Chloro-5-Fluorobenzoxazole
- 2-Chloro-5-fluoro-benzoxazole
- 2-Chloro-6-fluoro-1,3-benzoxazole
- 2-Chloro-6-fluorobenzoxazole
- Benzoxazole, 2-chloro-6-fluoro-
- 2-Chloro-6-fluorobenzo[d]oxazole
Sort by
Found 4 products.
2-Chloro-6-fluorobenzo[d]oxazole
CAS:Formula:C7H3ClFNOPurity:95%Color and Shape:SolidMolecular weight:171.55622-Chloro-6-fluorobenzo[d]oxazole
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:171.559997558593752-Chloro-6-fluorobenzo[d]oxazole
CAS:2-Chloro-6-fluorobenzo[d]oxazoles is a compound with diverse applications in various fields. It has been found to have antimicrobial properties, making it a potential ingredient in the development of new antimicrobial agents. Additionally, it has been used in research as a calmodulin inhibitor, which plays a crucial role in various biological processes. The compound's unique structure and properties make it valuable for medicinal research and the synthesis of novel drugs. With its ability to modulate biological processes and its potential therapeutic applications, 2-Chloro-6-fluorobenzo[d]oxazoles is an exciting compound for researchers and scientists alike.Formula:C7H3ClFNOPurity:Min. 95%Molecular weight:171.56 g/molRef: 3D-FC41943
Discontinued product2-Chloro-6-fluoro-1,3-benzoxazole
CAS:2-Chloro-6-fluoro-1,3-benzoxazoleFormula:C7H3ClFNOPurity:By hplc: 95.7% by area (210nm) (Typical Value in Batch COA)Color and Shape: very dark brown to black crystalline solidMolecular weight:171.56g/mol