CAS 1539-06-6: 4-(Acetylamino)-3-nitrobenzoic acid
Formula:C9H8N2O5
InChI:InChI=1S/C9H8N2O5/c1-5(12)10-7-3-2-6(9(13)14)4-8(7)11(15)16/h2-4H,1H3,(H,10,12)(H,13,14)
InChI key:InChIKey=BRQIMWBIZLRLSV-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC(C)=O)C=CC(C(O)=O)=C1
Synonyms:- 3-Nitro-4-acetamidobenzoic acid
- 4-(Acetylamino)-3-Nitrobenzoate
- 4-(Acetylamino)-3-Nitrobenzoic Acid
- Benzoic Acid, 4-(Acetylamino)-3-Nitro-
- Benzoic acid, 4-acetamido-3-nitro-
- NSC 190738
- 4-Acetamido-3-nitrobenzoic acid
Sort by
Found 5 products.
4-Acetamido-3-nitrobenzoic acid
CAS:Formula:C9H8N2O5Purity:98%Color and Shape:SolidMolecular weight:224.17024-(Acetylamino)-3-nitrobenzoic acid
CAS:4-(Acetylamino)-3-nitrobenzoic acid (AANBA) is a molecule that inhibits the growth of Mycobacterium tuberculosis and influenza virus. It has been shown to have tuberculostatic activity and is able to adsorb to the cavity of the enzyme protein, preventing access by other molecules. AANBA also has antiviral properties that may be due to its ability to inhibit viral particles from binding with a cell surface receptor or inhibiting the synthesis of viral proteins. AANBA binds to the chloride ion in order to maintain the negative charge of the molecule, which is crucial for its antiviral activity.Formula:C9H8N2O5Purity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:224.17 g/mol4-Acetamido-3-nitrobenzoic acid
CAS:4-Acetamido-3-nitrobenzoic acidPurity:98+%Molecular weight:224.17g/mol
