
CAS 156101-08-5: Erinacine A
Formula:C25H36O6
InChI:InChI=1S/C25H36O6/c1-14(2)16-7-8-24(3)9-10-25(4)17(20(16)24)6-5-15(12-26)11-19(25)31-23-22(29)21(28)18(27)13-30-23/h5-6,12,14,18-19,21-23,27-29H,7-11,13H2,1-4H3/t18-,19+,21+,22-,23+,24-,25-/m1/s1
InChI key:InChIKey=LPPCHLAEVDUIIW-NLLUTMDRSA-N
SMILES:C[C@]12C(C=3[C@](C)([C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](O)CO4)CC(C=O)=CC3)CC1)=C(C(C)C)CC2
Synonyms:- (+)-Erinacin A
- Cyclohept[e]indene-8-carboxaldehyde, 2,3,3a,4,5,5a,6,7-octahydro-3a,5a-dimethyl-1-(1-methylethyl)-6-(β-D-xylopyranosyloxy)-, [3aR-(3aα,5aβ,6α)]-
- Erinacin A
- (3aR,5aR,6S)-2,3,3a,4,5,5a,6,7-Octahydro-3a,5a-dimethyl-1-(1-methylethyl)-6-(β-D-xylopyranosyloxy)cyclohept[e]indene-8-carboxaldehyde
- Cyclohept[e]indene-8-carboxaldehyde, 2,3,3a,4,5,5a,6,7-octahydro-3a,5a-dimethyl-1-(1-methylethyl)-6-(β-D-xylopyranosyloxy)-, (3aR,5aR,6S)-
Sort by
Found 4 products.
Erinacine A
CAS:Erinacine A ((+)-Erinacin A) is a cyanoalkane diterpene derived from the monkey fungus, a neuroprotective agent with anticancer activity.Formula:C25H36O6Purity:99.82%Color and Shape:SoildMolecular weight:432.55(+)-Erinacin A
CAS:(+)-Erinacin A is a bioactive compound, specifically a cyathane diterpenoid, which is isolated from the mushroom Hericium erinaceus, commonly known as the Lion’s Mane mushroom. This compound is notable for its mode of action that involves the induction of nerve growth factor (NGF) synthesis, which is crucial in supporting neuronal growth, maintenance, and repair. (+)-Erinacin A exhibits potential neuroprotective and neuroregenerative properties, making it a subject of significant interest in neurobiological research. Its ability to enhance NGF synthesis suggests potential applications in treating neurodegenerative diseases such as Alzheimer's and Parkinson's, where neuronal damage is prevalent. Furthermore, preliminary studies indicate potential roles in cognitive enhancement and the alleviation of neuropathic pain, though more research is necessary to fully elucidate its mechanisms and therapeutic potential. Scientists are particularly interested in exploring its efficacy and safety across various models to determine the compound's feasibility as a candidate for pharmaceutical development.Formula:C25H36O6Purity:Min. 95%Color and Shape:PowderMolecular weight:432.5 g/mol