CAS 156939-62-7: (9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate
Formula:C17H15NO3
InChI:InChI=1/C17H15NO3/c19-10-9-18-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,10,16H,9,11H2,(H,18,20)
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=NCC=O)O
Synonyms:- 9H-Fluoren-9-ylmethyl (2-oxoethyl)carbamate
- carbamic acid, N-(2-oxoethyl)-, 9H-fluoren-9-ylmethyl ester
Sort by
Found 4 products.
Carbamic acid, N-(2-oxoethyl)-, 9H-fluoren-9-ylmethyl ester
CAS:Formula:C17H15NO3Purity:96%Color and Shape:SolidMolecular weight:281.3059(9H-Fluoren-9-yl)methyl (2-oxoethyl)carbamate
CAS:Retinoic acid is a retinoid that is used in the treatment of acne, psoriasis, and other disorders. It is also used to treat acute promyelocytic leukemia. Retinoic acid is synthesized industrially by an amide coupling process from 9-fluorenylmethyl (2-oxoethyl)carbamate and 2,6-dichlorobenzoyl chloride. The synthesis of retinoic acid begins with a reaction between the amine group on 9-fluorenylmethyl (2-oxoethyl)carbamate and the carboxylic acid group on 2,6-dichlorobenzoyl chloride to form an amide bond. This amide bond is then hydrolyzed to form retinoic acid. Impurities such as hydrogen fluoride and polypeptides are removed during the synthesis process. Trifluoroacetic acid is added to convert any remaining impurities into water soluble byproductsFormula:C17H15NO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:281.31 g/molRef: 3D-FF140899
Discontinued product(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate
CAS:(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamatePurity:95%Molecular weight:281.31g/mol(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:281.3110046386719
