
CAS 1570-06-5: 5,6,7-Trimethoxy-2-(2-methoxyphenyl)-4H-1-benzopyran-4-one
Formula:C19H18O6
InChI:InChI=1S/C19H18O6/c1-21-13-8-6-5-7-11(13)14-9-12(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3
InChI key:InChIKey=VJQCNJZQBZZIKI-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=C(OC)C=CC=C3)=CC(OC)=C1OC
Synonyms:- Flavone, 2′,5,6,7-tetramethoxy-
- 5,6,7-Trimethoxy-2-(2-methoxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,6,7-trimethoxy-2-(2-methoxyphenyl)-
Sort by
Found 1 products.
5,6,7,2'-Tetramethoxyflavone
CAS:5,6,7,2'-Tetramethoxyflavone is a naturally occurring flavonoid, which is a type of polyphenolic compound. It is predominantly sourced from various plant species known for their medicinal properties. Flavonoids are typically derived from the intricate biochemical pathways in plants, where they contribute to the plant's defense mechanisms against environmental stressors. The mode of action of 5,6,7,2'-Tetramethoxyflavone involves modulation of various cellular pathways. It exhibits potential antioxidant activity by scavenging free radicals, thereby reducing oxidative stress in cells. Additionally, it can influence signaling pathways that are crucial for cell proliferation and apoptosis, which underscores its potential therapeutic applications. The applications of 5,6,7,2'-Tetramethoxyflavone are diverse and primarily centered around its pharmacological properties. Research indicates its potential role in managing inflammatory conditions, with studies highlighting its ability to modulate inflammatory cytokines. Furthermore, investigations into its anticancer activity are ongoing, with promising data on its capacity to inhibit the growth of certain cancer cell lines. Its widespread implications in medicinal chemistry make it a compound of interest for further scientific exploration, especially in the development of new therapeutic agents.Formula:C19H18O6Purity:Min. 95%Molecular weight:342.34 g/mol