
CAS 157069-48-2: 4-(4H-1,2,4-triazol-4-yl)benzoic acid
Formula:C9H7N3O2
InChI:InChI=1/C9H7N3O2/c13-9(14)7-1-3-8(4-2-7)12-5-10-11-6-12/h1-6H,(H,13,14)
SMILES:c1cc(ccc1C(=O)O)n1cnnc1
Synonyms:- benzoic acid, 4-(4H-1,2,4-triazol-4-yl)-
Sort by
Found 5 products.
Benzoic acid, 4-(4H-1,2,4-triazol-4-yl)-
CAS:Formula:C9H7N3O2Purity:98%Color and Shape:SolidMolecular weight:189.17084-(4H-1,2,4-Triazol-4-yl)benzoic Acid
CAS:Formula:C9H7N3O2Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:189.174-[1,2,4]Triazol-4-yl-benzoic acid
CAS:4-Triazol-4-ylbenzoic acid is a bifunctional molecule that can be used to activate carboxylate groups. 4-Triazol-4-ylbenzoic acid contains chloride and nitrogen atoms, which are necessary for the chemical stability of the compound. This molecule has been shown to have luminescence properties in the presence of various metals and metal ions, such as copper and silver ions. 4-Triazol-4-ylbenzoic acid is also stable in basic solutions due to its basic structure. The crystal x-ray diffraction of this molecule shows that it has a linker that can bind with water molecules and form an H2O tetramer.Formula:C9H7N3O2Purity:Min. 95%Molecular weight:189.2 g/mol4-(4H-1,2,4-Triazol-4-yl)benzoic acid
CAS:4-(4H-1,2,4-Triazol-4-yl)benzoic acidPurity:98%Molecular weight:189.17g/mol4-(4H-1,2,4-triazol-4-yl)benzoic acid
CAS:Purity:95.0%Color and Shape:Solid, White powderMolecular weight:189.1739959716797